About H-Dmt-Tic-Gly-N(Me)-Ph
H-Dmt-Tic-Gly-N(Me)-Ph (PubChem CID 25034012) has the molecular formula C30H34N4O4
and a molecular weight of 514.60 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]-N-[2-(N-methylanilino)-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
Molecular Properties
| Compound Name | H-Dmt-Tic-Gly-N(Me)-Ph |
| PubChem CID | 25034012 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | (3S)-2-[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]-N-[2-(N-methylanilino)-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC1=CC(=CC(=C1C[C@@H](C(=O)N2CC3=CC=CC=C3C[C@H]2C(=O)NCC(=O)N(C)C4=CC=CC=C4)N)C)O |
| InChI | InChI=1S/C30H34N4O4/c1-19-13-24(35)14-20(2)25(19)16-26(31)30(38)34-18-22-10-8-7-9-21(22)15-27(34)29(37)32-17-28(36)33(3)23-11-5-4-6-12-23/h4-14,26-27,35H,15-18,31H2,1-3H3,(H,32,37)/t26-,27-/m0/s1 |
| InChIKey | CADRNJIFUDEZBB-SVBPBHIXSA-N |
| XLogP | 3.20 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | 819 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze H-Dmt-Tic-Gly-N(Me)-Ph with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of H-Dmt-Tic-Gly-N(Me)-Ph?
The IUPAC name of H-Dmt-Tic-Gly-N(Me)-Ph (CID 25034012) is (3S)-2-[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]-N-[2-(N-methylanilino)-2-oxoethyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
What is the SMILES notation for H-Dmt-Tic-Gly-N(Me)-Ph?
The canonical SMILES for H-Dmt-Tic-Gly-N(Me)-Ph is CC1=CC(=CC(=C1C[C@@H](C(=O)N2CC3=CC=CC=C3C[C@H]2C(=O)NCC(=O)N(C)C4=CC=CC=C4)N)C)O.
What is the InChIKey of H-Dmt-Tic-Gly-N(Me)-Ph?
The InChIKey is CADRNJIFUDEZBB-SVBPBHIXSA-N. The full InChI is InChI=1S/C30H34N4O4/c1-19-13-24(35)14-20(2)25(19)16-26(31)30(38)34-18-22-10-8-7-9-21(22)15-27(34)29(37)32-17-28(36)33(3)23-11-5-4-6-12-23/h4-14,26-27,35H,15-18,31H2,1-3H3,(H,32,37)/t26-,27-/m0/s1.
What are the key properties of H-Dmt-Tic-Gly-N(Me)-Ph?
H-Dmt-Tic-Gly-N(Me)-Ph has a molecular weight of 514.60 g/mol, XLogP of 3.20, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for H-Dmt-Tic-Gly-N(Me)-Ph is sourced from PubChem (CID 25034012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).