C24H29NO7 — CID 25034038
methyl (3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate (PubChem CID 25034038) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl (3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate.
| Compound Name | methyl (3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 25034038 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | methyl (3aR,6R,6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-[(4-methoxyphenyl)methyl]-6a-methyl-2,4-dioxo-3,3a-dihydrofuro[2,3-c]pyrrole-6-carboxylate |
| SMILES | COC(=O)[C@]1([C@@H](O)[C@@H]2C=CCCC2)N(Cc2ccc(OC)cc2)C(=O)[C@@H]2CC(=O)O[C@@]21C |
| InChI | InChI=1S/C24H29NO7/c1-23-18(13-19(26)32-23)21(28)25(14-15-9-11-17(30-2)12-10-15)24(23,22(29)31-3)20(27)16-7-5-4-6-8-16/h5,7,9-12,16,18,20,27H,4,6,8,13-14H2,1-3H3/t16-,18+,20+,23+,24+/m1/s1 |
| InChIKey | KDDXJUPXSSNRLP-YJYRJYHESA-N |
| XLogP | 1.99 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|