About 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate
5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate (PubChem CID 25034097) has the molecular formula C17H34O5Si
and a molecular weight of 346.54 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
Molecular Properties
| Compound Name | 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| PubChem CID | 25034097 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| SMILES | CCOC(=O)C[C@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-10-20-14(18)11-13(12-15(19)21-16(2,3)4)22-23(8,9)17(5,6)7/h13H,10-12H2,1-9H3/t13-/m1/s1 |
| InChIKey | YMWRRNKSXGCJGA-CYBMUJFWSA-N |
| XLogP | 4.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The IUPAC name of 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate (CID 25034097) is 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
What is the SMILES notation for 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The canonical SMILES for 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate is CCOC(=O)C[C@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The InChIKey is YMWRRNKSXGCJGA-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H34O5Si/c1-10-20-14(18)11-13(12-15(19)21-16(2,3)4)22-23(8,9)17(5,6)7/h13H,10-12H2,1-9H3/t13-/m1/s1.
What are the key properties of 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate has a molecular weight of 346.54 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-tert-butyl 1-O-ethyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate is sourced from PubChem (CID 25034097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).