C14H19ClO5 — CID 25034179
methyl (3aS,4S,7R,7aS)-4-chloro-7-hydroxyspiro[3a,4,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate (PubChem CID 25034179) has the molecular formula C14H19ClO5 and a molecular weight of 302.75 g/mol. Its IUPAC name is methyl (3aS,4S,7R,7aS)-4-chloro-7-hydroxyspiro[3a,4,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate.
| Compound Name | methyl (3aS,4S,7R,7aS)-4-chloro-7-hydroxyspiro[3a,4,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate |
|---|---|
| PubChem CID | 25034179 |
| Molecular Formula | C14H19ClO5 |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | methyl (3aS,4S,7R,7aS)-4-chloro-7-hydroxyspiro[3a,4,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1Cl |
| InChI | InChI=1S/C14H19ClO5/c1-18-13(17)8-7-9(16)11-12(10(8)15)20-14(19-11)5-3-2-4-6-14/h7,9-12,16H,2-6H2,1H3/t9-,10+,11+,12-/m1/s1 |
| InChIKey | XGYILYAZRVUZKL-NOOOWODRSA-N |
| XLogP | 1.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|