C21H22O6 — CID 25034321
(8S,10S)-21-hydroxy-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraene-3,15-dione (PubChem CID 25034321) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (8S,10S)-21-hydroxy-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraene-3,15-dione.
| Compound Name | (8S,10S)-21-hydroxy-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraene-3,15-dione |
|---|---|
| PubChem CID | 25034321 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (8S,10S)-21-hydroxy-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraene-3,15-dione |
| SMILES | O=C1C=CC2(C=C1)CC[C@]1(CC(O)C[C@]3(CCC4(C=CC(=O)C=C4)O3)O1)O2 |
| InChI | InChI=1S/C21H22O6/c22-15-1-5-18(6-2-15)9-11-20(25-18)13-17(24)14-21(27-20)12-10-19(26-21)7-3-16(23)4-8-19/h1-8,17,24H,9-14H2/t20-,21-/m0/s1 |
| InChIKey | BWUOKXCUQDTZQU-SFTDATJTSA-N |
| XLogP | 2.04 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |