C28H34O7 — CID 25034404
[(8S,10R)-3,15-dioxo-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraen-21-yl] heptanoate (PubChem CID 25034404) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is [(8S,10R)-3,15-dioxo-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraen-21-yl] heptanoate.
| Compound Name | [(8S,10R)-3,15-dioxo-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraen-21-yl] heptanoate |
|---|---|
| PubChem CID | 25034404 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [(8S,10R)-3,15-dioxo-7,9,11-trioxatetraspiro[5.1.1.1.512.210.38.26]tetracosa-1,4,13,16-tetraen-21-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC1C[C@]2(CCC3(C=CC(=O)C=C3)O2)O[C@]2(CCC3(C=CC(=O)C=C3)O2)C1 |
| InChI | InChI=1S/C28H34O7/c1-2-3-4-5-6-24(31)32-23-19-27(17-15-25(33-27)11-7-21(29)8-12-25)35-28(20-23)18-16-26(34-28)13-9-22(30)10-14-26/h7-14,23H,2-6,15-20H2,1H3/t23?,27-,28+ |
| InChIKey | FMTRESOBDJZRGR-YGQVVATNSA-N |
| XLogP | 4.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|