About N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide
N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25035415) has the molecular formula C16H18N2O5S
and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
| PubChem CID | 25035415 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCCC2)=C(S(=O)(=O)NCCO)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H18N2O5S/c19-10-7-17-24(22,23)16-13(18-8-3-4-9-18)14(20)11-5-1-2-6-12(11)15(16)21/h1-2,5-6,17,19H,3-4,7-10H2 |
| InChIKey | FACUUOLLGINMKE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide?
The IUPAC name of N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide (CID 25035415) is N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide.
What is the SMILES notation for N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide?
The canonical SMILES for N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide is O=C1C(N2CCCC2)=C(S(=O)(=O)NCCO)C(=O)c2ccccc21.
What is the InChIKey of N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide?
The InChIKey is FACUUOLLGINMKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5S/c19-10-7-17-24(22,23)16-13(18-8-3-4-9-18)14(20)11-5-1-2-6-12(11)15(16)21/h1-2,5-6,17,19H,3-4,7-10H2.
What are the key properties of N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide?
N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide has a molecular weight of 350.40 g/mol, XLogP of 0.28, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide is sourced from PubChem (CID 25035415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).