About imino-methyl-oxo-phenyl-λ6-sulfane
imino-methyl-oxo-phenyl-λ6-sulfane (PubChem CID 25036286) has the molecular formula C7H9NOS
and a molecular weight of 155.22 g/mol. Its IUPAC name is imino-methyl-oxo-phenyl-λ6-sulfane.
Molecular Properties
| Compound Name | imino-methyl-oxo-phenyl-λ6-sulfane |
| PubChem CID | 25036286 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | imino-methyl-oxo-phenyl-λ6-sulfane |
| SMILES | [H]N=[S@](C)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H9NOS/c1-10(8,9)7-5-3-2-4-6-7/h2-6,8H,1H3/t10-/m1/s1 |
| InChIKey | YFYIDTVGWCYSEO-SNVBAGLBSA-N |
| XLogP | 1.72 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze imino-methyl-oxo-phenyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-methyl-oxo-phenyl-λ6-sulfane?
The IUPAC name of imino-methyl-oxo-phenyl-λ6-sulfane (CID 25036286) is imino-methyl-oxo-phenyl-λ6-sulfane.
What is the SMILES notation for imino-methyl-oxo-phenyl-λ6-sulfane?
The canonical SMILES for imino-methyl-oxo-phenyl-λ6-sulfane is [H]N=[S@](C)(=O)c1ccccc1.
What is the InChIKey of imino-methyl-oxo-phenyl-λ6-sulfane?
The InChIKey is YFYIDTVGWCYSEO-SNVBAGLBSA-N. The full InChI is InChI=1S/C7H9NOS/c1-10(8,9)7-5-3-2-4-6-7/h2-6,8H,1H3/t10-/m1/s1.
What are the key properties of imino-methyl-oxo-phenyl-λ6-sulfane?
imino-methyl-oxo-phenyl-λ6-sulfane has a molecular weight of 155.22 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imino-methyl-oxo-phenyl-λ6-sulfane is sourced from PubChem (CID 25036286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).