C30H30N2O5S — CID 25037018
4-[7,7-dimethyl-2,5-dioxo-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide (PubChem CID 25037018) has the molecular formula C30H30N2O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is 4-[7,7-dimethyl-2,5-dioxo-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide.
| Compound Name | 4-[7,7-dimethyl-2,5-dioxo-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25037018 |
| Molecular Formula | C30H30N2O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 4-[7,7-dimethyl-2,5-dioxo-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinolin-1-yl]benzenesulfonamide |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(S(N)(=O)=O)cc1)C(=O)CC2c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O5S/c1-30(2)17-26-29(27(33)18-30)25(16-28(34)32(26)22-10-14-24(15-11-22)38(31,35)36)21-8-12-23(13-9-21)37-19-20-6-4-3-5-7-20/h3-15,25H,16-19H2,1-2H3,(H2,31,35,36) |
| InChIKey | VHCDJQVJPSNITL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |