C23H37NO2SSi — CID 25037193
triethyl-[(1S,7R)-5-(N-methyl-S-phenylsulfonimidoyl)-7-propan-2-ylcyclohepta-2,5-dien-1-yl]oxysilane (PubChem CID 25037193) has the molecular formula C23H37NO2SSi and a molecular weight of 419.71 g/mol. Its IUPAC name is triethyl-[(1S,7R)-5-(N-methyl-S-phenylsulfonimidoyl)-7-propan-2-ylcyclohepta-2,5-dien-1-yl]oxysilane.
| Compound Name | triethyl-[(1S,7R)-5-(N-methyl-S-phenylsulfonimidoyl)-7-propan-2-ylcyclohepta-2,5-dien-1-yl]oxysilane |
|---|---|
| PubChem CID | 25037193 |
| Molecular Formula | C23H37NO2SSi |
| Molecular Weight | 419.71 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | triethyl-[(1S,7R)-5-(N-methyl-S-phenylsulfonimidoyl)-7-propan-2-ylcyclohepta-2,5-dien-1-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1C=CCC([S@@](=O)(=NC)c2ccccc2)=C[C@H]1C(C)C |
| InChI | InChI=1S/C23H37NO2SSi/c1-7-28(8-2,9-3)26-23-17-13-16-21(18-22(23)19(4)5)27(25,24-6)20-14-11-10-12-15-20/h10-15,17-19,22-23H,7-9,16H2,1-6H3/t22-,23-,27+/m0/s1 |
| InChIKey | NKPABXKRKJMAMS-VMODYCNZSA-N |
| XLogP | 6.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|