C25H37NO3S — CID 25037195
[(3S,4R,5E)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-propan-2-ylnona-5,8-dien-3-yl] pent-4-enoate (PubChem CID 25037195) has the molecular formula C25H37NO3S and a molecular weight of 431.64 g/mol. Its IUPAC name is [(3S,4R,5E)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-propan-2-ylnona-5,8-dien-3-yl] pent-4-enoate.
| Compound Name | [(3S,4R,5E)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-propan-2-ylnona-5,8-dien-3-yl] pent-4-enoate |
|---|---|
| PubChem CID | 25037195 |
| Molecular Formula | C25H37NO3S |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | [(3S,4R,5E)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-propan-2-ylnona-5,8-dien-3-yl] pent-4-enoate |
| SMILES | C=CCCC(=O)O[C@@H](C(C)C)[C@@H](/C=C(\CC=C)[S@@](=O)(=NC)c1ccccc1)C(C)C |
| InChI | InChI=1S/C25H37NO3S/c1-8-10-17-24(27)29-25(20(5)6)23(19(3)4)18-22(14-9-2)30(28,26-7)21-15-12-11-13-16-21/h8-9,11-13,15-16,18-20,23,25H,1-2,10,14,17H2,3-7H3/b22-18+/t23-,25-,30+/m0/s1 |
| InChIKey | YAOWFUGKNKNSFF-UNRLPOFPSA-N |
| XLogP | 6.41 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|