C23H33NO3S — CID 25037196
(5Z,8E,10R,11S)-8-(N-methyl-S-phenylsulfonimidoyl)-10,11-di(propan-2-yl)-1-oxacycloundeca-5,8-dien-2-one (PubChem CID 25037196) has the molecular formula C23H33NO3S and a molecular weight of 403.59 g/mol. Its IUPAC name is (5Z,8E,10R,11S)-8-(N-methyl-S-phenylsulfonimidoyl)-10,11-di(propan-2-yl)-1-oxacycloundeca-5,8-dien-2-one.
| Compound Name | (5Z,8E,10R,11S)-8-(N-methyl-S-phenylsulfonimidoyl)-10,11-di(propan-2-yl)-1-oxacycloundeca-5,8-dien-2-one |
|---|---|
| PubChem CID | 25037196 |
| Molecular Formula | C23H33NO3S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | (5Z,8E,10R,11S)-8-(N-methyl-S-phenylsulfonimidoyl)-10,11-di(propan-2-yl)-1-oxacycloundeca-5,8-dien-2-one |
| SMILES | CN=[S@](=O)(/C1=C/[C@@H](C(C)C)[C@H](C(C)C)OC(=O)CC/C=C\C1)c1ccccc1 |
| InChI | InChI=1S/C23H33NO3S/c1-17(2)21-16-20(28(26,24-5)19-12-8-6-9-13-19)14-10-7-11-15-22(25)27-23(21)18(3)4/h6-10,12-13,16-18,21,23H,11,14-15H2,1-5H3/b10-7-,20-16+/t21-,23-,28+/m0/s1 |
| InChIKey | DGRHWMISQYEOMX-FUEYNSQGSA-N |
| XLogP | 5.61 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|