C23H27N3O4S — CID 25037624
N-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]piperidin-4-yl]quinoline-8-sulfonamide (PubChem CID 25037624) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]piperidin-4-yl]quinoline-8-sulfonamide.
| Compound Name | N-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]piperidin-4-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 25037624 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[1-[[4-(2-hydroxyethoxy)phenyl]methyl]piperidin-4-yl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(Cc2ccc(OCCO)cc2)CC1)c1cccc2cccnc12 |
| InChI | InChI=1S/C23H27N3O4S/c27-15-16-30-21-8-6-18(7-9-21)17-26-13-10-20(11-14-26)25-31(28,29)22-5-1-3-19-4-2-12-24-23(19)22/h1-9,12,20,25,27H,10-11,13-17H2 |
| InChIKey | NZPLQPVWTPFZHX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |