About 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid
3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid (PubChem CID 25040269) has the molecular formula C21H21N3O4S
and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid |
| PubChem CID | 25040269 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1/N=C/c1cc(C)n(-c2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C21H21N3O4S/c1-13-4-5-16(21(25)26)11-20(13)23-12-17-10-14(2)24(15(17)3)18-6-8-19(9-7-18)29(22,27)28/h4-12H,1-3H3,(H,25,26)(H2,22,27,28)/b23-12+ |
| InChIKey | DUMNLVXHAVJCGM-FSJBWODESA-N |
| XLogP | 3.50 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid?
The IUPAC name of 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid (CID 25040269) is 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid.
What is the SMILES notation for 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid?
The canonical SMILES for 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid is Cc1ccc(C(=O)O)cc1/N=C/c1cc(C)n(-c2ccc(S(N)(=O)=O)cc2)c1C.
What is the InChIKey of 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid?
The InChIKey is DUMNLVXHAVJCGM-FSJBWODESA-N. The full InChI is InChI=1S/C21H21N3O4S/c1-13-4-5-16(21(25)26)11-20(13)23-12-17-10-14(2)24(15(17)3)18-6-8-19(9-7-18)29(22,27)28/h4-12H,1-3H3,(H,25,26)(H2,22,27,28)/b23-12+.
What are the key properties of 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid?
3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid has a molecular weight of 411.48 g/mol, XLogP of 3.50, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,5-dimethyl-1-(4-sulfamoylphenyl)pyrrol-3-yl]methylideneamino]-4-methylbenzoic acid is sourced from PubChem (CID 25040269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).