C26H25N3O3S — CID 2504049
N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 2504049) has the molecular formula C26H25N3O3S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2504049 |
| Molecular Formula | C26H25N3O3S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[4-(2,4-dimethylphenyl)sulfanylphenyl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(Sc2ccc(NC(=O)CN3C(=O)N[C@](C)(c4ccccc4)C3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C26H25N3O3S/c1-17-9-14-22(18(2)15-17)33-21-12-10-20(11-13-21)27-23(30)16-29-24(31)26(3,28-25(29)32)19-7-5-4-6-8-19/h4-15H,16H2,1-3H3,(H,27,30)(H,28,32)/t26-/m1/s1 |
| InChIKey | FOXAXDSGHRGCOK-AREMUKBSSA-N |
| XLogP | 4.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|