About 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide
2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide (PubChem CID 2504178) has the molecular formula C18H13ClFN3O4
and a molecular weight of 389.77 g/mol. Its IUPAC name is 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide |
| PubChem CID | 2504178 |
| Molecular Formula | C18H13ClFN3O4 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(Cc2ccccc2)C1=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H13ClFN3O4/c19-13-8-12(6-7-14(13)20)21-15(24)10-23-17(26)16(25)22(18(23)27)9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,21,24) |
| InChIKey | CSLZCIUPBUGDRW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide?
The IUPAC name of 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide (CID 2504178) is 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide.
What is the SMILES notation for 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide?
The canonical SMILES for 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide is O=C(CN1C(=O)C(=O)N(Cc2ccccc2)C1=O)Nc1ccc(F)c(Cl)c1.
What is the InChIKey of 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide?
The InChIKey is CSLZCIUPBUGDRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClFN3O4/c19-13-8-12(6-7-14(13)20)21-15(24)10-23-17(26)16(25)22(18(23)27)9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,21,24).
What are the key properties of 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide?
2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide has a molecular weight of 389.77 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3-chloro-4-fluorophenyl)acetamide is sourced from PubChem (CID 2504178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).