C20H29N3O5S — CID 25045753
N-tert-butyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,3-dimethylbutanamide (PubChem CID 25045753) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-tert-butyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,3-dimethylbutanamide.
| Compound Name | N-tert-butyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 25045753 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-tert-butyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)N(C1CC(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O)C(C)(C)C |
| InChI | InChI=1S/C20H29N3O5S/c1-19(2,3)12-17(25)23(20(4,5)6)15-11-16(24)22(18(15)26)13-7-9-14(10-8-13)29(21,27)28/h7-10,15H,11-12H2,1-6H3,(H2,21,27,28) |
| InChIKey | UBCNQZXQTIVAKO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|