C27H21N3O4S — CID 25045980
N-[2-(1,3-benzoxazol-2-yl)phenyl]-2-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 25045980) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-yl)phenyl]-2-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(1,3-benzoxazol-2-yl)phenyl]-2-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 25045980 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-yl)phenyl]-2-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C(=O)Nc2ccccc2-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C27H21N3O4S/c1-18-14-16-19(17-15-18)35(32,33)30-23-11-5-2-8-20(23)26(31)28-22-10-4-3-9-21(22)27-29-24-12-6-7-13-25(24)34-27/h2-17,30H,1H3,(H,28,31) |
| InChIKey | JPUZLMRDTSHEPO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |