About 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide
8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide (PubChem CID 25047106) has the molecular formula C16H20ClNO2S
and a molecular weight of 325.86 g/mol. Its IUPAC name is 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide.
Molecular Properties
| Compound Name | 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide |
| PubChem CID | 25047106 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc2cccc(Cl)c12)C(C)(C)C |
| InChI | InChI=1S/C16H20ClNO2S/c1-11(16(2,3)4)18-21(19,20)14-10-6-8-12-7-5-9-13(17)15(12)14/h5-11,18H,1-4H3/t11-/m1/s1 |
| InChIKey | IOVCKSKYTXDEAW-LLVKDONJSA-N |
| XLogP | 4.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide?
The IUPAC name of 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide (CID 25047106) is 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide.
What is the SMILES notation for 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide?
The canonical SMILES for 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide is C[C@@H](NS(=O)(=O)c1cccc2cccc(Cl)c12)C(C)(C)C.
What is the InChIKey of 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide?
The InChIKey is IOVCKSKYTXDEAW-LLVKDONJSA-N. The full InChI is InChI=1S/C16H20ClNO2S/c1-11(16(2,3)4)18-21(19,20)14-10-6-8-12-7-5-9-13(17)15(12)14/h5-11,18H,1-4H3/t11-/m1/s1.
What are the key properties of 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide?
8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide has a molecular weight of 325.86 g/mol, XLogP of 4.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N-[(2R)-3,3-dimethylbutan-2-yl]naphthalene-1-sulfonamide is sourced from PubChem (CID 25047106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).