About N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide
N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide (PubChem CID 25047487) has the molecular formula C23H23FN2O3S
and a molecular weight of 426.51 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide |
| PubChem CID | 25047487 |
| Molecular Formula | C23H23FN2O3S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(S(=O)(=O)NCCc3ccccc3)ccc2F)cc1C |
| InChI | InChI=1S/C23H23FN2O3S/c1-16-8-9-19(14-17(16)2)26-23(27)21-15-20(10-11-22(21)24)30(28,29)25-13-12-18-6-4-3-5-7-18/h3-11,14-15,25H,12-13H2,1-2H3,(H,26,27) |
| InChIKey | XIIPIVVYFAGHOM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide?
The IUPAC name of N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide (CID 25047487) is N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide.
What is the SMILES notation for N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide?
The canonical SMILES for N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide is Cc1ccc(NC(=O)c2cc(S(=O)(=O)NCCc3ccccc3)ccc2F)cc1C.
What is the InChIKey of N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide?
The InChIKey is XIIPIVVYFAGHOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN2O3S/c1-16-8-9-19(14-17(16)2)26-23(27)21-15-20(10-11-22(21)24)30(28,29)25-13-12-18-6-4-3-5-7-18/h3-11,14-15,25H,12-13H2,1-2H3,(H,26,27).
What are the key properties of N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide?
N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide has a molecular weight of 426.51 g/mol, XLogP of 4.22, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-2-fluoro-5-(2-phenylethylsulfamoyl)benzamide is sourced from PubChem (CID 25047487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).