About 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide
4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide (PubChem CID 25048179) has the molecular formula C22H18N2O4S
and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide |
| PubChem CID | 25048179 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCn2c(=O)c3ccccc3c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C22H18N2O4S/c23-29(27,28)16-11-9-15(10-12-16)13-14-24-21(25)19-7-3-1-5-17(19)18-6-2-4-8-20(18)22(24)26/h1-12H,13-14H2,(H2,23,27,28) |
| InChIKey | WDLRTSLTGWUYMU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide?
The IUPAC name of 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide (CID 25048179) is 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide?
The canonical SMILES for 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide is NS(=O)(=O)c1ccc(CCn2c(=O)c3ccccc3c3ccccc3c2=O)cc1.
What is the InChIKey of 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide?
The InChIKey is WDLRTSLTGWUYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O4S/c23-29(27,28)16-11-9-15(10-12-16)13-14-24-21(25)19-7-3-1-5-17(19)18-6-2-4-8-20(18)22(24)26/h1-12H,13-14H2,(H2,23,27,28).
What are the key properties of 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide?
4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide has a molecular weight of 406.46 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(5,7-dioxobenzo[d][2]benzazepin-6-yl)ethyl]benzenesulfonamide is sourced from PubChem (CID 25048179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).