About N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide
N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide (PubChem CID 25049099) has the molecular formula C17H17N3O6S3
and a molecular weight of 455.54 g/mol. Its IUPAC name is N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide |
| PubChem CID | 25049099 |
| Molecular Formula | C17H17N3O6S3 |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(C3CC3)S(=O)(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C17H17N3O6S3/c18-28(23,24)13-7-5-11(6-8-13)19-15(21)10-14(17(19)22)20(12-3-4-12)29(25,26)16-2-1-9-27-16/h1-2,5-9,12,14H,3-4,10H2,(H2,18,23,24) |
| InChIKey | VLPUSRQAAOWLKG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide?
The IUPAC name of N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide (CID 25049099) is N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide.
What is the SMILES notation for N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide?
The canonical SMILES for N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide is NS(=O)(=O)c1ccc(N2C(=O)CC(N(C3CC3)S(=O)(=O)c3cccs3)C2=O)cc1.
What is the InChIKey of N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide?
The InChIKey is VLPUSRQAAOWLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O6S3/c18-28(23,24)13-7-5-11(6-8-13)19-15(21)10-14(17(19)22)20(12-3-4-12)29(25,26)16-2-1-9-27-16/h1-2,5-9,12,14H,3-4,10H2,(H2,18,23,24).
What are the key properties of N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide?
N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide has a molecular weight of 455.54 g/mol, XLogP of 0.88, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 25049099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).