C26H30N6O3S3 — CID 25049200
2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide (PubChem CID 25049200) has the molecular formula C26H30N6O3S3 and a molecular weight of 570.77 g/mol. Its IUPAC name is 2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide.
| Compound Name | 2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 25049200 |
| Molecular Formula | C26H30N6O3S3 |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 2-[(6-tert-butyl-3-cyano-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(NC(=O)C(C)Sc3nc4c(cc3C#N)CC(C(C)(C)C)CC4)cc2)s1 |
| InChI | InChI=1S/C26H30N6O3S3/c1-15(36-24-18(14-27)12-17-13-19(26(3,4)5)6-11-22(17)29-24)23(33)28-20-7-9-21(10-8-20)38(34,35)32-25-31-30-16(2)37-25/h7-10,12,15,19H,6,11,13H2,1-5H3,(H,28,33)(H,31,32) |
| InChIKey | KSEWFKRBVYLYQR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 137.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |