C18H19N3O3S2 — CID 2504960
2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 2504960) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 2504960 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-(4,8-dimethylquinolin-2-yl)sulfanyl-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | Cc1cc(SCC(=O)NCCN2C(=O)CSC2=O)nc2c(C)cccc12 |
| InChI | InChI=1S/C18H19N3O3S2/c1-11-4-3-5-13-12(2)8-15(20-17(11)13)25-9-14(22)19-6-7-21-16(23)10-26-18(21)24/h3-5,8H,6-7,9-10H2,1-2H3,(H,19,22) |
| InChIKey | LWPQKINFOIKEMJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|