About N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine
N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine (PubChem CID 25050248) has the molecular formula C20H13ClF2N4
and a molecular weight of 382.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine |
| PubChem CID | 25050248 |
| Molecular Formula | C20H13ClF2N4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine |
| SMILES | Fc1ccc2c(CN(c3cccc(Cl)c3)c3ncccn3)cncc2c1F |
| InChI | InChI=1S/C20H13ClF2N4/c21-14-3-1-4-15(9-14)27(20-25-7-2-8-26-20)12-13-10-24-11-17-16(13)5-6-18(22)19(17)23/h1-11H,12H2 |
| InChIKey | AOCBNXDMMFBXEF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine?
The IUPAC name of N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine (CID 25050248) is N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine.
What is the SMILES notation for N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine?
The canonical SMILES for N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine is Fc1ccc2c(CN(c3cccc(Cl)c3)c3ncccn3)cncc2c1F.
What is the InChIKey of N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine?
The InChIKey is AOCBNXDMMFBXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClF2N4/c21-14-3-1-4-15(9-14)27(20-25-7-2-8-26-20)12-13-10-24-11-17-16(13)5-6-18(22)19(17)23/h1-11H,12H2.
What are the key properties of N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine?
N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine has a molecular weight of 382.80 g/mol, XLogP of 5.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-N-[(7,8-difluoroisoquinolin-4-yl)methyl]pyrimidin-2-amine is sourced from PubChem (CID 25050248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).