About 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole
5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole (PubChem CID 25050336) has the molecular formula C19H19NO2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole.
Molecular Properties
| Compound Name | 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole |
| PubChem CID | 25050336 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole |
| SMILES | COc1cc(/C=C\c2ccc3c(ccn3C)c2)cc(OC)c1 |
| InChI | InChI=1S/C19H19NO2/c1-20-9-8-16-10-14(6-7-19(16)20)4-5-15-11-17(21-2)13-18(12-15)22-3/h4-13H,1-3H3/b5-4- |
| InChIKey | NFMOFRZUFAIFPL-PLNGDYQASA-N |
| XLogP | 4.37 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole?
The IUPAC name of 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole (CID 25050336) is 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole.
What is the SMILES notation for 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole?
The canonical SMILES for 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole is COc1cc(/C=C\c2ccc3c(ccn3C)c2)cc(OC)c1.
What is the InChIKey of 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole?
The InChIKey is NFMOFRZUFAIFPL-PLNGDYQASA-N. The full InChI is InChI=1S/C19H19NO2/c1-20-9-8-16-10-14(6-7-19(16)20)4-5-15-11-17(21-2)13-18(12-15)22-3/h4-13H,1-3H3/b5-4-.
What are the key properties of 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole?
5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole has a molecular weight of 293.37 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]-1-methylindole is sourced from PubChem (CID 25050336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).