About 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine
4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine (PubChem CID 25051112) has the molecular formula C23H19N5OS
and a molecular weight of 413.51 g/mol. Its IUPAC name is 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine.
Molecular Properties
| Compound Name | 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine |
| PubChem CID | 25051112 |
| Molecular Formula | C23H19N5OS |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine |
| SMILES | c1cc2nc(-c3ccc4nc(-c5ccc(N6CCOCC6)cc5)[nH]c4c3)sc2cn1 |
| InChI | InChI=1S/C23H19N5OS/c1-4-17(28-9-11-29-12-10-28)5-2-15(1)22-25-18-6-3-16(13-20(18)26-22)23-27-19-7-8-24-14-21(19)30-23/h1-8,13-14H,9-12H2,(H,25,26) |
| InChIKey | NDPBXLKIHNZQQH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine?
The IUPAC name of 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine (CID 25051112) is 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine.
What is the SMILES notation for 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine?
The canonical SMILES for 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine is c1cc2nc(-c3ccc4nc(-c5ccc(N6CCOCC6)cc5)[nH]c4c3)sc2cn1.
What is the InChIKey of 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine?
The InChIKey is NDPBXLKIHNZQQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5OS/c1-4-17(28-9-11-29-12-10-28)5-2-15(1)22-25-18-6-3-16(13-20(18)26-22)23-27-19-7-8-24-14-21(19)30-23/h1-8,13-14H,9-12H2,(H,25,26).
What are the key properties of 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine?
4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine has a molecular weight of 413.51 g/mol, XLogP of 4.74, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[6-([1,3]thiazolo[5,4-c]pyridin-2-yl)-1H-benzimidazol-2-yl]phenyl]morpholine is sourced from PubChem (CID 25051112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).