C21H21F2N3O3S — CID 25051838
N-[4-[3-cyano-6-(difluoromethoxy)-1-ethylindol-2-yl]phenyl]propane-2-sulfonamide (PubChem CID 25051838) has the molecular formula C21H21F2N3O3S and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[4-[3-cyano-6-(difluoromethoxy)-1-ethylindol-2-yl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[4-[3-cyano-6-(difluoromethoxy)-1-ethylindol-2-yl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 25051838 |
| Molecular Formula | C21H21F2N3O3S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[4-[3-cyano-6-(difluoromethoxy)-1-ethylindol-2-yl]phenyl]propane-2-sulfonamide |
| SMILES | CCn1c(-c2ccc(NS(=O)(=O)C(C)C)cc2)c(C#N)c2ccc(OC(F)F)cc21 |
| InChI | InChI=1S/C21H21F2N3O3S/c1-4-26-19-11-16(29-21(22)23)9-10-17(19)18(12-24)20(26)14-5-7-15(8-6-14)25-30(27,28)13(2)3/h5-11,13,21,25H,4H2,1-3H3 |
| InChIKey | GEOUOFNUERJWKK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |