C19H24BNO3 — CID 25051993
(2S)-1-(1,3,2-dioxaborolan-2-yloxy)-3-methyl-1,1-diphenylbutan-2-amine (PubChem CID 25051993) has the molecular formula C19H24BNO3 and a molecular weight of 325.22 g/mol. Its IUPAC name is (2S)-1-(1,3,2-dioxaborolan-2-yloxy)-3-methyl-1,1-diphenylbutan-2-amine.
| Compound Name | (2S)-1-(1,3,2-dioxaborolan-2-yloxy)-3-methyl-1,1-diphenylbutan-2-amine |
|---|---|
| PubChem CID | 25051993 |
| Molecular Formula | C19H24BNO3 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2S)-1-(1,3,2-dioxaborolan-2-yloxy)-3-methyl-1,1-diphenylbutan-2-amine |
| SMILES | CC(C)[C@H](N)C(OB1OCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24BNO3/c1-15(2)18(21)19(16-9-5-3-6-10-16,17-11-7-4-8-12-17)24-20-22-13-14-23-20/h3-12,15,18H,13-14,21H2,1-2H3/t18-/m0/s1 |
| InChIKey | YJZIPVDPYPQAMN-SFHVURJKSA-N |
| XLogP | 2.96 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|