C22H22FN3O3 — CID 25052013
2-fluoroethyl N-[4-(3-cyano-6-ethoxy-1-ethylindol-2-yl)phenyl]carbamate (PubChem CID 25052013) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-fluoroethyl N-[4-(3-cyano-6-ethoxy-1-ethylindol-2-yl)phenyl]carbamate.
| Compound Name | 2-fluoroethyl N-[4-(3-cyano-6-ethoxy-1-ethylindol-2-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 25052013 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-fluoroethyl N-[4-(3-cyano-6-ethoxy-1-ethylindol-2-yl)phenyl]carbamate |
| SMILES | CCOc1ccc2c(C#N)c(-c3ccc(NC(=O)OCCF)cc3)n(CC)c2c1 |
| InChI | InChI=1S/C22H22FN3O3/c1-3-26-20-13-17(28-4-2)9-10-18(20)19(14-24)21(26)15-5-7-16(8-6-15)25-22(27)29-12-11-23/h5-10,13H,3-4,11-12H2,1-2H3,(H,25,27) |
| InChIKey | YTKRIIJWSGPXDA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |