C29H37N5O7 — CID 25052536
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid (PubChem CID 25052536) has the molecular formula C29H37N5O7 and a molecular weight of 567.64 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 25052536 |
| Molecular Formula | C29H37N5O7 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H37N5O7/c1-16(2)11-24(29(40)41)33-28(39)25(15-35)34-27(38)23(12-17-7-9-19(36)10-8-17)32-26(37)21(30)13-18-14-31-22-6-4-3-5-20(18)22/h3-10,14,16,21,23-25,31,35-36H,11-13,15,30H2,1-2H3,(H,32,37)(H,33,39)(H,34,38)(H,40,41)/t21-,23-,24-,25-/m0/s1 |
| InChIKey | BEGTZUPTEIHUQM-LFBFJMOVSA-N |
| XLogP | 0.56 |
| TPSA | 206.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |