C25H50O6Si — CID 25052809
(2S,3R,4R,6R)-6-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-ethyl-3-(methoxymethoxy)-4-methylheptanal (PubChem CID 25052809) has the molecular formula C25H50O6Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (2S,3R,4R,6R)-6-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-ethyl-3-(methoxymethoxy)-4-methylheptanal.
| Compound Name | (2S,3R,4R,6R)-6-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-ethyl-3-(methoxymethoxy)-4-methylheptanal |
|---|---|
| PubChem CID | 25052809 |
| Molecular Formula | C25H50O6Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.34 |
| IUPAC Name | (2S,3R,4R,6R)-6-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-ethyl-3-(methoxymethoxy)-4-methylheptanal |
| SMILES | CC[C@H](C=O)[C@H](OCOC)[C@H](C)C[C@@H](C)[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C25H50O6Si/c1-12-20(15-26)23(28-17-27-9)19(3)13-18(2)22-14-21(30-25(7,8)31-22)16-29-32(10,11)24(4,5)6/h15,18-23H,12-14,16-17H2,1-11H3/t18-,19-,20-,21+,22+,23-/m1/s1 |
| InChIKey | AKDBIAOHXLCYGB-LAAXVVMPSA-N |
| XLogP | 5.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|