C29H56O7Si — CID 25052810
ethyl (Z,4R,5R,6R,8R)-8-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-5-(methoxymethoxy)-6-methylnon-2-enoate (PubChem CID 25052810) has the molecular formula C29H56O7Si and a molecular weight of 544.85 g/mol. Its IUPAC name is ethyl (Z,4R,5R,6R,8R)-8-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-5-(methoxymethoxy)-6-methylnon-2-enoate.
| Compound Name | ethyl (Z,4R,5R,6R,8R)-8-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-5-(methoxymethoxy)-6-methylnon-2-enoate |
|---|---|
| PubChem CID | 25052810 |
| Molecular Formula | C29H56O7Si |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | ethyl (Z,4R,5R,6R,8R)-8-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-4-ethyl-5-(methoxymethoxy)-6-methylnon-2-enoate |
| SMILES | CCOC(=O)/C=C\C(CC)[C@H](OCOC)[C@H](C)C[C@@H](C)[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C29H56O7Si/c1-13-23(15-16-26(30)32-14-2)27(33-20-31-10)22(4)17-21(3)25-18-24(35-29(8,9)36-25)19-34-37(11,12)28(5,6)7/h15-16,21-25,27H,13-14,17-20H2,1-12H3/b16-15-/t21-,22-,23?,24+,25+,27-/m1/s1 |
| InChIKey | RUALZIFCFHXDDB-LXMPNVATSA-N |
| XLogP | 6.72 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|