C25H27Cl2N3OS — CID 25052923
N-butyl-1-(2,4-dichlorophenyl)-5-(5-hex-1-ynylthiophen-2-yl)-4-methylpyrazole-3-carboxamide (PubChem CID 25052923) has the molecular formula C25H27Cl2N3OS and a molecular weight of 488.48 g/mol. Its IUPAC name is N-butyl-1-(2,4-dichlorophenyl)-5-(5-hex-1-ynylthiophen-2-yl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-butyl-1-(2,4-dichlorophenyl)-5-(5-hex-1-ynylthiophen-2-yl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25052923 |
| Molecular Formula | C25H27Cl2N3OS |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-butyl-1-(2,4-dichlorophenyl)-5-(5-hex-1-ynylthiophen-2-yl)-4-methylpyrazole-3-carboxamide |
| SMILES | CCCCC#Cc1ccc(-c2c(C)c(C(=O)NCCCC)nn2-c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C25H27Cl2N3OS/c1-4-6-8-9-10-19-12-14-22(32-19)24-17(3)23(25(31)28-15-7-5-2)29-30(24)21-13-11-18(26)16-20(21)27/h11-14,16H,4-8,15H2,1-3H3,(H,28,31) |
| InChIKey | RYCHPZDRERWDKZ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|