C30H28Cl2N4OS — CID 25052992
1-(2,4-dichlorophenyl)-4-methyl-5-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]-N-piperidin-1-ylpyrazole-3-carboxamide (PubChem CID 25052992) has the molecular formula C30H28Cl2N4OS and a molecular weight of 563.55 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-methyl-5-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]-N-piperidin-1-ylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-4-methyl-5-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]-N-piperidin-1-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25052992 |
| Molecular Formula | C30H28Cl2N4OS |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-methyl-5-[5-(4-phenylbut-1-ynyl)thiophen-2-yl]-N-piperidin-1-ylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NN2CCCCC2)nn(-c2ccc(Cl)cc2Cl)c1-c1ccc(C#CCCc2ccccc2)s1 |
| InChI | InChI=1S/C30H28Cl2N4OS/c1-21-28(30(37)34-35-18-8-3-9-19-35)33-36(26-16-14-23(31)20-25(26)32)29(21)27-17-15-24(38-27)13-7-6-12-22-10-4-2-5-11-22/h2,4-5,10-11,14-17,20H,3,6,8-9,12,18-19H2,1H3,(H,34,37) |
| InChIKey | LLWJMTCYPFQWGT-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|