C31H41N3O — CID 25053285
4-cyano-N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide (PubChem CID 25053285) has the molecular formula C31H41N3O and a molecular weight of 471.69 g/mol. Its IUPAC name is 4-cyano-N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide.
| Compound Name | 4-cyano-N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide |
|---|---|
| PubChem CID | 25053285 |
| Molecular Formula | C31H41N3O |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 4-cyano-N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](N(C)C(=O)c6ccc(C#N)cc6)CC[C@]5(C)[C@H]4CC[C@]23CN1C |
| InChI | InChI=1S/C31H41N3O/c1-20-26-11-12-28-25-10-9-23-17-24(34(4)29(35)22-7-5-21(18-32)6-8-22)13-15-30(23,2)27(25)14-16-31(26,28)19-33(20)3/h5-9,20,24-28H,10-17,19H2,1-4H3/t20-,24-,25+,26+,27-,28-,30-,31-/m0/s1 |
| InChIKey | BGHMFFCWINSZMO-YTLNYRDXSA-N |
| XLogP | 5.89 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|