C29H38N8O8S — CID 25053413
[(2R,3S,4R,5R)-5-(6-amino-2-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine (PubChem CID 25053413) has the molecular formula C29H38N8O8S and a molecular weight of 658.74 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-amino-2-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine.
| Compound Name | [(2R,3S,4R,5R)-5-(6-amino-2-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
|---|---|
| PubChem CID | 25053413 |
| Molecular Formula | C29H38N8O8S |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2-anilinopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-(2-hydroxybenzoyl)sulfamate;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Nc1nc(Nc2ccccc2)nc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)c2ccccc2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H23N7O8S.C6H15N/c24-19-16-20(28-23(27-19)26-12-6-2-1-3-7-12)30(11-25-16)22-18(33)17(32)15(38-22)10-37-39(35,36)29-21(34)13-8-4-5-9-14(13)31;1-4-7(5-2)6-3/h1-9,11,15,17-18,22,31-33H,10H2,(H,29,34)(H3,24,26,27,28);4-6H2,1-3H3/t15-,17-,18-,22-;/m1./s1 |
| InChIKey | OZDZGHPHTJCPIJ-GIQPGJFOSA-N |
| XLogP | 1.52 |
| TPSA | 227.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |