C30H42N2O — CID 25053424
N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide (PubChem CID 25053424) has the molecular formula C30H42N2O and a molecular weight of 446.68 g/mol. Its IUPAC name is N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide.
| Compound Name | N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide |
|---|---|
| PubChem CID | 25053424 |
| Molecular Formula | C30H42N2O |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | N-methyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]benzamide |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](N(C)C(=O)c6ccccc6)CC[C@]5(C)[C@H]4CC[C@]23CN1C |
| InChI | InChI=1S/C30H42N2O/c1-20-25-12-13-27-24-11-10-22-18-23(32(4)28(33)21-8-6-5-7-9-21)14-16-29(22,2)26(24)15-17-30(25,27)19-31(20)3/h5-10,20,23-27H,11-19H2,1-4H3/t20-,23-,24+,25+,26-,27-,29-,30-/m0/s1 |
| InChIKey | TTZKMXJRVUDQEX-HKUZGXNYSA-N |
| XLogP | 6.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|