C25H36N2 — CID 25053476
3,4,8b-tris(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 25053476) has the molecular formula C25H36N2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 3,4,8b-tris(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | 3,4,8b-tris(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 25053476 |
| Molecular Formula | C25H36N2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | 3,4,8b-tris(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | CC(C)=CCN1CCC2(CC=C(C)C)c3ccccc3N(CC=C(C)C)C12 |
| InChI | InChI=1S/C25H36N2/c1-19(2)11-14-25-15-18-26(16-12-20(3)4)24(25)27(17-13-21(5)6)23-10-8-7-9-22(23)25/h7-13,24H,14-18H2,1-6H3 |
| InChIKey | QXNSFPSGHIXUGR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|