C22H32N2O — CID 25053537
7-methoxy-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 25053537) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 7-methoxy-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | 7-methoxy-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 25053537 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 7-methoxy-3-methyl-4,8b-bis(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | COc1ccc2c(c1)C1(CC=C(C)C)CCN(C)C1N2CC=C(C)C |
| InChI | InChI=1S/C22H32N2O/c1-16(2)9-11-22-12-14-23(5)21(22)24(13-10-17(3)4)20-8-7-18(25-6)15-19(20)22/h7-10,15,21H,11-14H2,1-6H3 |
| InChIKey | ONFAZZRKNWUZAY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|