C22H22N2O7 — CID 25053592
[(4E)-2-(hydroxymethyl)-4-[(4-nitrophenyl)methylidene]-5-oxooxolan-2-yl]methyl 4-(dimethylamino)benzoate (PubChem CID 25053592) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is [(4E)-2-(hydroxymethyl)-4-[(4-nitrophenyl)methylidene]-5-oxooxolan-2-yl]methyl 4-(dimethylamino)benzoate.
| Compound Name | [(4E)-2-(hydroxymethyl)-4-[(4-nitrophenyl)methylidene]-5-oxooxolan-2-yl]methyl 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 25053592 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [(4E)-2-(hydroxymethyl)-4-[(4-nitrophenyl)methylidene]-5-oxooxolan-2-yl]methyl 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC2(CO)C/C(=C\c3ccc([N+](=O)[O-])cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C22H22N2O7/c1-23(2)18-9-5-16(6-10-18)20(26)30-14-22(13-25)12-17(21(27)31-22)11-15-3-7-19(8-4-15)24(28)29/h3-11,25H,12-14H2,1-2H3/b17-11+ |
| InChIKey | PDFSDYZOTUUNJY-GZTJUZNOSA-N |
| XLogP | 2.58 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|