C31H34O6 — CID 25053694
(2S,3R,4S,5R,6R)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(prop-2-ynoxymethyl)oxane (PubChem CID 25053694) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(prop-2-ynoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(prop-2-ynoxymethyl)oxane |
|---|---|
| PubChem CID | 25053694 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-methoxy-3,4,5-tris(phenylmethoxy)-6-(prop-2-ynoxymethyl)oxane |
| SMILES | C#CCOC[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H34O6/c1-3-19-33-23-27-28(34-20-24-13-7-4-8-14-24)29(35-21-25-15-9-5-10-16-25)30(31(32-2)37-27)36-22-26-17-11-6-12-18-26/h1,4-18,27-31H,19-23H2,2H3/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | RGHHKYOMBWTTMT-SAEUYMBFSA-N |
| XLogP | 4.76 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|