About [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate
[(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate (PubChem CID 25053784) has the molecular formula C24H29NO5
and a molecular weight of 411.50 g/mol. Its IUPAC name is [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate.
Molecular Properties
| Compound Name | [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate |
| PubChem CID | 25053784 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCC1(CO)C/C(=C\c2cnc3ccccc3c2)C(=O)O1 |
| InChI | InChI=1S/C24H29NO5/c1-3-7-18(8-4-2)22(27)29-16-24(15-26)13-20(23(28)30-24)12-17-11-19-9-5-6-10-21(19)25-14-17/h5-6,9-12,14,18,26H,3-4,7-8,13,15-16H2,1-2H3/b20-12+ |
| InChIKey | NZYNTDGHNYYHKJ-UDWIEESQSA-N |
| XLogP | 4.06 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate?
The IUPAC name of [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate (CID 25053784) is [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate.
What is the SMILES notation for [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate?
The canonical SMILES for [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate is CCCC(CCC)C(=O)OCC1(CO)C/C(=C\c2cnc3ccccc3c2)C(=O)O1.
What is the InChIKey of [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate?
The InChIKey is NZYNTDGHNYYHKJ-UDWIEESQSA-N. The full InChI is InChI=1S/C24H29NO5/c1-3-7-18(8-4-2)22(27)29-16-24(15-26)13-20(23(28)30-24)12-17-11-19-9-5-6-10-21(19)25-14-17/h5-6,9-12,14,18,26H,3-4,7-8,13,15-16H2,1-2H3/b20-12+.
What are the key properties of [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate?
[(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate has a molecular weight of 411.50 g/mol, XLogP of 4.06, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E)-2-(hydroxymethyl)-5-oxo-4-(quinolin-3-ylmethylidene)oxolan-2-yl]methyl 2-propylpentanoate is sourced from PubChem (CID 25053784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).