C27H46O5 — CID 25053798
ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate (PubChem CID 25053798) has the molecular formula C27H46O5 and a molecular weight of 450.66 g/mol. Its IUPAC name is ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 25053798 |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | ethyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12R)-12-hydroxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC[C@H](C)[C@@H](/C(C)=C/C=C/[C@@H](C)C/C(C)=C/[C@H](C)[C@@H](OC)[C@@H](C)O)O1 |
| InChI | InChI=1S/C27H46O5/c1-9-31-25(29)17-24-14-13-21(5)26(32-24)20(4)12-10-11-18(2)15-19(3)16-22(6)27(30-8)23(7)28/h10-12,16,18,21-24,26-28H,9,13-15,17H2,1-8H3/b11-10+,19-16+,20-12+/t18-,21+,22+,23-,24-,26-,27-/m1/s1 |
| InChIKey | JWPGVOVKOFLDLR-DIIMOSALSA-N |
| XLogP | 5.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|