C29H51NO5Si — CID 25053806
(2R,4R)-4-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpentanamide (PubChem CID 25053806) has the molecular formula C29H51NO5Si and a molecular weight of 521.82 g/mol. Its IUPAC name is (2R,4R)-4-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpentanamide.
| Compound Name | (2R,4R)-4-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpentanamide |
|---|---|
| PubChem CID | 25053806 |
| Molecular Formula | C29H51NO5Si |
| Molecular Weight | 521.82 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | (2R,4R)-4-[(4S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N,2-dimethylpentanamide |
| SMILES | C[C@H](C[C@@H](C)[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)(C)O1)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C29H51NO5Si/c1-20(17-21(2)27(32)30(9)22(3)26(31)23-15-13-12-14-16-23)25-18-24(34-29(7,8)35-25)19-33-36(10,11)28(4,5)6/h12-16,20-22,24-26,31H,17-19H2,1-11H3/t20-,21-,22+,24+,25+,26-/m1/s1 |
| InChIKey | NNSPSYPVXSWZLC-FQERZCAZSA-N |
| XLogP | 6.16 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.82 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|