C20H25N7O2 — CID 25053851
7-(2,2-dimethylpropyl)-6-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile (PubChem CID 25053851) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-6-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile.
| Compound Name | 7-(2,2-dimethylpropyl)-6-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 25053851 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-6-[(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
| SMILES | CC(C)(C)Cn1c(CN2C(=O)NC3(CCNCC3)C2=O)cc2cnc(C#N)nc21 |
| InChI | InChI=1S/C20H25N7O2/c1-19(2,3)12-27-14(8-13-10-23-15(9-21)24-16(13)27)11-26-17(28)20(25-18(26)29)4-6-22-7-5-20/h8,10,22H,4-7,11-12H2,1-3H3,(H,25,29) |
| InChIKey | UKJMYPORNSQINW-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|