About benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate
benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate (PubChem CID 25053999) has the molecular formula C30H32N2O4
and a molecular weight of 484.60 g/mol. Its IUPAC name is benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate |
| PubChem CID | 25053999 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate |
| SMILES | O=C(CC(NCC(=O)N1CCC2(CC1)OCc1ccccc12)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C30H32N2O4/c33-28(32-17-15-30(16-18-32)26-14-8-7-13-25(26)22-36-30)20-31-27(24-11-5-2-6-12-24)19-29(34)35-21-23-9-3-1-4-10-23/h1-14,27,31H,15-22H2 |
| InChIKey | CFPZRHQYYNSKDH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate?
The IUPAC name of benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate (CID 25053999) is benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate.
What is the SMILES notation for benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate?
The canonical SMILES for benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate is O=C(CC(NCC(=O)N1CCC2(CC1)OCc1ccccc12)c1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate?
The InChIKey is CFPZRHQYYNSKDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2O4/c33-28(32-17-15-30(16-18-32)26-14-8-7-13-25(26)22-36-30)20-31-27(24-11-5-2-6-12-24)19-29(34)35-21-23-9-3-1-4-10-23/h1-14,27,31H,15-22H2.
What are the key properties of benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate?
benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate has a molecular weight of 484.60 g/mol, XLogP of 4.50, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[(2-oxo-2-spiro[1H-2-benzofuran-3,4'-piperidine]-1'-ylethyl)amino]-3-phenylpropanoate is sourced from PubChem (CID 25053999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).