About 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one
1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one (PubChem CID 25054011) has the molecular formula C26H26F2N4O2
and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one.
Molecular Properties
| Compound Name | 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one |
| PubChem CID | 25054011 |
| Molecular Formula | C26H26F2N4O2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one |
| SMILES | O=c1cc(OCc2ccccc2)ccn1-c1ccc2c(cnn2CCN2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C26H26F2N4O2/c27-26(28)9-12-30(13-10-26)14-15-32-24-7-6-22(16-21(24)18-29-32)31-11-8-23(17-25(31)33)34-19-20-4-2-1-3-5-20/h1-8,11,16-18H,9-10,12-15,19H2 |
| InChIKey | GCJMHKAUUNWTKU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one?
The IUPAC name of 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one (CID 25054011) is 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one.
What is the SMILES notation for 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one?
The canonical SMILES for 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one is O=c1cc(OCc2ccccc2)ccn1-c1ccc2c(cnn2CCN2CCC(F)(F)CC2)c1.
What is the InChIKey of 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one?
The InChIKey is GCJMHKAUUNWTKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26F2N4O2/c27-26(28)9-12-30(13-10-26)14-15-32-24-7-6-22(16-21(24)18-29-32)31-11-8-23(17-25(31)33)34-19-20-4-2-1-3-5-20/h1-8,11,16-18H,9-10,12-15,19H2.
What are the key properties of 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one?
1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one has a molecular weight of 464.52 g/mol, XLogP of 4.50, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[2-(4,4-difluoropiperidin-1-yl)ethyl]indazol-5-yl]-4-phenylmethoxypyridin-2-one is sourced from PubChem (CID 25054011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).