About (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine
(E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine (PubChem CID 25054182) has the molecular formula C15H25N5O2
and a molecular weight of 307.40 g/mol. Its IUPAC name is (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine.
Molecular Properties
| Compound Name | (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine |
| PubChem CID | 25054182 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine |
| SMILES | Cc1cncn1CCCN/C(=C\[N+](=O)[O-])NC1CCCCC1 |
| InChI | InChI=1S/C15H25N5O2/c1-13-10-16-12-19(13)9-5-8-17-15(11-20(21)22)18-14-6-3-2-4-7-14/h10-12,14,17-18H,2-9H2,1H3/b15-11+ |
| InChIKey | ZOWJSWANGDEHQV-RVDMUPIBSA-N |
| XLogP | 2.17 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine?
The IUPAC name of (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine (CID 25054182) is (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine.
What is the SMILES notation for (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine?
The canonical SMILES for (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine is Cc1cncn1CCCN/C(=C\[N+](=O)[O-])NC1CCCCC1.
What is the InChIKey of (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine?
The InChIKey is ZOWJSWANGDEHQV-RVDMUPIBSA-N. The full InChI is InChI=1S/C15H25N5O2/c1-13-10-16-12-19(13)9-5-8-17-15(11-20(21)22)18-14-6-3-2-4-7-14/h10-12,14,17-18H,2-9H2,1H3/b15-11+.
What are the key properties of (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine?
(E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine has a molecular weight of 307.40 g/mol, XLogP of 2.17, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-N'-cyclohexyl-1-N-[3-(5-methylimidazol-1-yl)propyl]-2-nitroethene-1,1-diamine is sourced from PubChem (CID 25054182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).