About 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol
3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol (PubChem CID 25054362) has the molecular formula C13H9N3O2
and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol |
| PubChem CID | 25054362 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol |
| SMILES | Oc1cccc(-c2nnc(-c3cccnc3)o2)c1 |
| InChI | InChI=1S/C13H9N3O2/c17-11-5-1-3-9(7-11)12-15-16-13(18-12)10-4-2-6-14-8-10/h1-8,17H |
| InChIKey | YCJCSYPIWDGPKX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol?
The IUPAC name of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol (CID 25054362) is 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol.
What is the SMILES notation for 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol?
The canonical SMILES for 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol is Oc1cccc(-c2nnc(-c3cccnc3)o2)c1.
What is the InChIKey of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol?
The InChIKey is YCJCSYPIWDGPKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2/c17-11-5-1-3-9(7-11)12-15-16-13(18-12)10-4-2-6-14-8-10/h1-8,17H.
What are the key properties of 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol?
3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol has a molecular weight of 239.23 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)phenol is sourced from PubChem (CID 25054362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).